C11H15NO — CID 84767449
1-(4-amino-3,5-dimethylphenyl)propan-2-one (PubChem CID 84767449) has the molecular formula C11H15NO and a molecular weight of 177.25 g/mol. Its IUPAC name is 1-(4-amino-3,5-dimethylphenyl)propan-2-one.
| Compound Name | 1-(4-amino-3,5-dimethylphenyl)propan-2-one |
|---|---|
| PubChem CID | 84767449 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | 1-(4-amino-3,5-dimethylphenyl)propan-2-one |
| SMILES | CC(=O)Cc1cc(C)c(N)c(C)c1 |
| InChI | InChI=1S/C11H15NO/c1-7-4-10(6-9(3)13)5-8(2)11(7)12/h4-5H,6,12H2,1-3H3 |
| InChIKey | UUMPIXDSERDMJN-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|