C14H21NO — CID 101046615
1-(4-amino-3,5-dimethylphenyl)-3,3-dimethylbutan-2-one (PubChem CID 101046615) has the molecular formula C14H21NO and a molecular weight of 219.33 g/mol. Its IUPAC name is 1-(4-amino-3,5-dimethylphenyl)-3,3-dimethylbutan-2-one.
| Compound Name | 1-(4-amino-3,5-dimethylphenyl)-3,3-dimethylbutan-2-one |
|---|---|
| PubChem CID | 101046615 |
| Molecular Formula | C14H21NO |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.16 |
| IUPAC Name | 1-(4-amino-3,5-dimethylphenyl)-3,3-dimethylbutan-2-one |
| SMILES | Cc1cc(CC(=O)C(C)(C)C)cc(C)c1N |
| InChI | InChI=1S/C14H21NO/c1-9-6-11(7-10(2)13(9)15)8-12(16)14(3,4)5/h6-7H,8,15H2,1-5H3 |
| InChIKey | OZZCTJPPXYSJAE-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|