C13H16OS — CID 84686139
1-(2-cyclobutylsulfanylphenyl)propan-2-one (PubChem CID 84686139) has the molecular formula C13H16OS and a molecular weight of 220.34 g/mol. Its IUPAC name is 1-(2-cyclobutylsulfanylphenyl)propan-2-one.
| Compound Name | 1-(2-cyclobutylsulfanylphenyl)propan-2-one |
|---|---|
| PubChem CID | 84686139 |
| Molecular Formula | C13H16OS |
| Molecular Weight | 220.34 g/mol |
| Exact Mass | 220.09 |
| IUPAC Name | 1-(2-cyclobutylsulfanylphenyl)propan-2-one |
| SMILES | CC(=O)Cc1ccccc1SC1CCC1 |
| InChI | InChI=1S/C13H16OS/c1-10(14)9-11-5-2-3-8-13(11)15-12-6-4-7-12/h2-3,5,8,12H,4,6-7,9H2,1H3 |
| InChIKey | KFSZOTREBFUYPU-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.34 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |