C15H20OS — CID 62721722
1-[2-(3-methylcyclohexyl)sulfanylphenyl]ethanone (PubChem CID 62721722) has the molecular formula C15H20OS and a molecular weight of 248.39 g/mol. Its IUPAC name is 1-[2-(3-methylcyclohexyl)sulfanylphenyl]ethanone.
| Compound Name | 1-[2-(3-methylcyclohexyl)sulfanylphenyl]ethanone |
|---|---|
| PubChem CID | 62721722 |
| Molecular Formula | C15H20OS |
| Molecular Weight | 248.39 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | 1-[2-(3-methylcyclohexyl)sulfanylphenyl]ethanone |
| SMILES | CC(=O)c1ccccc1SC1CCCC(C)C1 |
| InChI | InChI=1S/C15H20OS/c1-11-6-5-7-13(10-11)17-15-9-4-3-8-14(15)12(2)16/h3-4,8-9,11,13H,5-7,10H2,1-2H3 |
| InChIKey | QUZSXZDKVZWRNT-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.39 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |