C16H22O2S — CID 82975836
methyl 2-[(3-methylcyclohexyl)sulfanylmethyl]benzoate (PubChem CID 82975836) has the molecular formula C16H22O2S and a molecular weight of 278.42 g/mol. Its IUPAC name is methyl 2-[(3-methylcyclohexyl)sulfanylmethyl]benzoate.
| Compound Name | methyl 2-[(3-methylcyclohexyl)sulfanylmethyl]benzoate |
|---|---|
| PubChem CID | 82975836 |
| Molecular Formula | C16H22O2S |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | methyl 2-[(3-methylcyclohexyl)sulfanylmethyl]benzoate |
| SMILES | COC(=O)c1ccccc1CSC1CCCC(C)C1 |
| InChI | InChI=1S/C16H22O2S/c1-12-6-5-8-14(10-12)19-11-13-7-3-4-9-15(13)16(17)18-2/h3-4,7,9,12,14H,5-6,8,10-11H2,1-2H3 |
| InChIKey | XXPFHPIPLOWKDT-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |