C16H21FO2S — CID 106698651
methyl 2-fluoro-4-[(3-methylcyclohexyl)sulfanylmethyl]benzoate (PubChem CID 106698651) has the molecular formula C16H21FO2S and a molecular weight of 296.41 g/mol. Its IUPAC name is methyl 2-fluoro-4-[(3-methylcyclohexyl)sulfanylmethyl]benzoate.
| Compound Name | methyl 2-fluoro-4-[(3-methylcyclohexyl)sulfanylmethyl]benzoate |
|---|---|
| PubChem CID | 106698651 |
| Molecular Formula | C16H21FO2S |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | methyl 2-fluoro-4-[(3-methylcyclohexyl)sulfanylmethyl]benzoate |
| SMILES | COC(=O)c1ccc(CSC2CCCC(C)C2)cc1F |
| InChI | InChI=1S/C16H21FO2S/c1-11-4-3-5-13(8-11)20-10-12-6-7-14(15(17)9-12)16(18)19-2/h6-7,9,11,13H,3-5,8,10H2,1-2H3 |
| InChIKey | MOGHOJPPURCAKF-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |