C11H16OS2 — CID 117329270
1-[2,3-bis(methylsulfanyl)phenyl]propan-2-ol (PubChem CID 117329270) has the molecular formula C11H16OS2 and a molecular weight of 228.38 g/mol. Its IUPAC name is 1-[2,3-bis(methylsulfanyl)phenyl]propan-2-ol.
| Compound Name | 1-[2,3-bis(methylsulfanyl)phenyl]propan-2-ol |
|---|---|
| PubChem CID | 117329270 |
| Molecular Formula | C11H16OS2 |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | 1-[2,3-bis(methylsulfanyl)phenyl]propan-2-ol |
| SMILES | CSc1cccc(CC(C)O)c1SC |
| InChI | InChI=1S/C11H16OS2/c1-8(12)7-9-5-4-6-10(13-2)11(9)14-3/h4-6,8,12H,7H2,1-3H3 |
| InChIKey | ADGNQHFHOARTAW-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |