C12H12N4O — CID 117328786
4-(7-methoxy-1H-indol-4-yl)-1H-pyrazol-5-amine (PubChem CID 117328786) has the molecular formula C12H12N4O and a molecular weight of 228.26 g/mol. Its IUPAC name is 4-(7-methoxy-1H-indol-4-yl)-1H-pyrazol-5-amine.
| Compound Name | 4-(7-methoxy-1H-indol-4-yl)-1H-pyrazol-5-amine |
|---|---|
| PubChem CID | 117328786 |
| Molecular Formula | C12H12N4O |
| Molecular Weight | 228.26 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 4-(7-methoxy-1H-indol-4-yl)-1H-pyrazol-5-amine |
| SMILES | COc1ccc(-c2cn[nH]c2N)c2cc[nH]c12 |
| InChI | InChI=1S/C12H12N4O/c1-17-10-3-2-7(8-4-5-14-11(8)10)9-6-15-16-12(9)13/h2-6,14H,1H3,(H3,13,15,16) |
| InChIKey | SRFQSMRKHWCLDI-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 79.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.26 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |