C24H32O6S — CID 11733053
diethyl 2-[(3S,5S)-10-(4-methylphenyl)sulfonylspiro[4.5]dec-9-en-3-yl]propanedioate (PubChem CID 11733053) has the molecular formula C24H32O6S and a molecular weight of 448.58 g/mol. Its IUPAC name is diethyl 2-[(3S,5S)-10-(4-methylphenyl)sulfonylspiro[4.5]dec-9-en-3-yl]propanedioate.
| Compound Name | diethyl 2-[(3S,5S)-10-(4-methylphenyl)sulfonylspiro[4.5]dec-9-en-3-yl]propanedioate |
|---|---|
| PubChem CID | 11733053 |
| Molecular Formula | C24H32O6S |
| Molecular Weight | 448.58 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | diethyl 2-[(3S,5S)-10-(4-methylphenyl)sulfonylspiro[4.5]dec-9-en-3-yl]propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)[C@H]1CC[C@@]2(CCCC=C2S(=O)(=O)c2ccc(C)cc2)C1 |
| InChI | InChI=1S/C24H32O6S/c1-4-29-22(25)21(23(26)30-5-2)18-13-15-24(16-18)14-7-6-8-20(24)31(27,28)19-11-9-17(3)10-12-19/h8-12,18,21H,4-7,13-16H2,1-3H3/t18-,24-/m0/s1 |
| InChIKey | RYUACPAFMRGKGC-UUOWRZLLSA-N |
| XLogP | 4.37 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.58 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|