C9H6ClFO4 — CID 117337074
2-(5-chloro-3-fluoro-2-hydroxy-6-methylphenyl)-2-oxoacetic acid (PubChem CID 117337074) has the molecular formula C9H6ClFO4 and a molecular weight of 232.59 g/mol. Its IUPAC name is 2-(5-chloro-3-fluoro-2-hydroxy-6-methylphenyl)-2-oxoacetic acid.
| Compound Name | 2-(5-chloro-3-fluoro-2-hydroxy-6-methylphenyl)-2-oxoacetic acid |
|---|---|
| PubChem CID | 117337074 |
| Molecular Formula | C9H6ClFO4 |
| Molecular Weight | 232.59 g/mol |
| Exact Mass | 231.99 |
| IUPAC Name | 2-(5-chloro-3-fluoro-2-hydroxy-6-methylphenyl)-2-oxoacetic acid |
| SMILES | Cc1c(Cl)cc(F)c(O)c1C(=O)C(=O)O |
| InChI | InChI=1S/C9H6ClFO4/c1-3-4(10)2-5(11)7(12)6(3)8(13)9(14)15/h2,12H,1H3,(H,14,15) |
| InChIKey | CHRZIIGQHLVCPH-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.59 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|