C8H3BrF2O4 — CID 117450954
2-(3-bromo-2,5-difluoro-6-hydroxyphenyl)-2-oxoacetic acid (PubChem CID 117450954) has the molecular formula C8H3BrF2O4 and a molecular weight of 281.01 g/mol. Its IUPAC name is 2-(3-bromo-2,5-difluoro-6-hydroxyphenyl)-2-oxoacetic acid.
| Compound Name | 2-(3-bromo-2,5-difluoro-6-hydroxyphenyl)-2-oxoacetic acid |
|---|---|
| PubChem CID | 117450954 |
| Molecular Formula | C8H3BrF2O4 |
| Molecular Weight | 281.01 g/mol |
| Exact Mass | 279.92 |
| IUPAC Name | 2-(3-bromo-2,5-difluoro-6-hydroxyphenyl)-2-oxoacetic acid |
| SMILES | O=C(O)C(=O)c1c(O)c(F)cc(Br)c1F |
| InChI | InChI=1S/C8H3BrF2O4/c9-2-1-3(10)6(12)4(5(2)11)7(13)8(14)15/h1,12H,(H,14,15) |
| InChIKey | IQWGYOWSRAYQHJ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.01 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|