C11H8ClN3O — CID 117339578
3-(3-chloro-1H-indol-4-yl)-1,2-oxazol-5-amine (PubChem CID 117339578) has the molecular formula C11H8ClN3O and a molecular weight of 233.66 g/mol. Its IUPAC name is 3-(3-chloro-1H-indol-4-yl)-1,2-oxazol-5-amine.
| Compound Name | 3-(3-chloro-1H-indol-4-yl)-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 117339578 |
| Molecular Formula | C11H8ClN3O |
| Molecular Weight | 233.66 g/mol |
| Exact Mass | 233.04 |
| IUPAC Name | 3-(3-chloro-1H-indol-4-yl)-1,2-oxazol-5-amine |
| SMILES | Nc1cc(-c2cccc3[nH]cc(Cl)c23)no1 |
| InChI | InChI=1S/C11H8ClN3O/c12-7-5-14-8-3-1-2-6(11(7)8)9-4-10(13)16-15-9/h1-5,14H,13H2 |
| InChIKey | FLOCMGTUBVIOCS-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.66 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |