C10H6F2N2O3 — CID 117352451
3-(2,2-difluoro-1,3-benzodioxol-4-yl)-1,2-oxazol-5-amine (PubChem CID 117352451) has the molecular formula C10H6F2N2O3 and a molecular weight of 240.17 g/mol. Its IUPAC name is 3-(2,2-difluoro-1,3-benzodioxol-4-yl)-1,2-oxazol-5-amine.
| Compound Name | 3-(2,2-difluoro-1,3-benzodioxol-4-yl)-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 117352451 |
| Molecular Formula | C10H6F2N2O3 |
| Molecular Weight | 240.17 g/mol |
| Exact Mass | 240.03 |
| IUPAC Name | 3-(2,2-difluoro-1,3-benzodioxol-4-yl)-1,2-oxazol-5-amine |
| SMILES | Nc1cc(-c2cccc3c2OC(F)(F)O3)no1 |
| InChI | InChI=1S/C10H6F2N2O3/c11-10(12)15-7-3-1-2-5(9(7)16-10)6-4-8(13)17-14-6/h1-4H,13H2 |
| InChIKey | KCMIGCOEBXZXAI-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 70.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.17 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |