C12H15FN4 — CID 117340419
4-[3-fluoro-4-(1,2,4-triazol-1-yl)phenyl]butan-1-amine (PubChem CID 117340419) has the molecular formula C12H15FN4 and a molecular weight of 234.28 g/mol. Its IUPAC name is 4-[3-fluoro-4-(1,2,4-triazol-1-yl)phenyl]butan-1-amine.
| Compound Name | 4-[3-fluoro-4-(1,2,4-triazol-1-yl)phenyl]butan-1-amine |
|---|---|
| PubChem CID | 117340419 |
| Molecular Formula | C12H15FN4 |
| Molecular Weight | 234.28 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | 4-[3-fluoro-4-(1,2,4-triazol-1-yl)phenyl]butan-1-amine |
| SMILES | NCCCCc1ccc(-n2cncn2)c(F)c1 |
| InChI | InChI=1S/C12H15FN4/c13-11-7-10(3-1-2-6-14)4-5-12(11)17-9-15-8-16-17/h4-5,7-9H,1-3,6,14H2 |
| InChIKey | OEOXZUSSNSDNGW-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.28 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|