About 2-(7-fluoro-2,3-dimethyl-1H-indol-5-yl)-2-oxoacetic acid
2-(7-fluoro-2,3-dimethyl-1H-indol-5-yl)-2-oxoacetic acid (PubChem CID 117341642) has the molecular formula C12H10FNO3
and a molecular weight of 235.21 g/mol. Its IUPAC name is 2-(7-fluoro-2,3-dimethyl-1H-indol-5-yl)-2-oxoacetic acid.
Molecular Properties
| Compound Name | 2-(7-fluoro-2,3-dimethyl-1H-indol-5-yl)-2-oxoacetic acid |
| PubChem CID | 117341642 |
| Molecular Formula | C12H10FNO3 |
| Molecular Weight | 235.21 g/mol |
| Exact Mass | 235.06 |
| IUPAC Name | 2-(7-fluoro-2,3-dimethyl-1H-indol-5-yl)-2-oxoacetic acid |
| SMILES | Cc1[nH]c2c(F)cc(C(=O)C(=O)O)cc2c1C |
| InChI | InChI=1S/C12H10FNO3/c1-5-6(2)14-10-8(5)3-7(4-9(10)13)11(15)12(16)17/h3-4,14H,1-2H3,(H,16,17) |
| InChIKey | ZZHNTTUNJLJMSV-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 70.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.21 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(7-fluoro-2,3-dimethyl-1H-indol-5-yl)-2-oxoacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(7-fluoro-2,3-dimethyl-1H-indol-5-yl)-2-oxoacetic acid?
The IUPAC name of 2-(7-fluoro-2,3-dimethyl-1H-indol-5-yl)-2-oxoacetic acid (CID 117341642) is 2-(7-fluoro-2,3-dimethyl-1H-indol-5-yl)-2-oxoacetic acid.
What is the SMILES notation for 2-(7-fluoro-2,3-dimethyl-1H-indol-5-yl)-2-oxoacetic acid?
The canonical SMILES for 2-(7-fluoro-2,3-dimethyl-1H-indol-5-yl)-2-oxoacetic acid is Cc1[nH]c2c(F)cc(C(=O)C(=O)O)cc2c1C.
What is the InChIKey of 2-(7-fluoro-2,3-dimethyl-1H-indol-5-yl)-2-oxoacetic acid?
The InChIKey is ZZHNTTUNJLJMSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10FNO3/c1-5-6(2)14-10-8(5)3-7(4-9(10)13)11(15)12(16)17/h3-4,14H,1-2H3,(H,16,17).
What are the key properties of 2-(7-fluoro-2,3-dimethyl-1H-indol-5-yl)-2-oxoacetic acid?
2-(7-fluoro-2,3-dimethyl-1H-indol-5-yl)-2-oxoacetic acid has a molecular weight of 235.21 g/mol, XLogP of 2.19, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(7-fluoro-2,3-dimethyl-1H-indol-5-yl)-2-oxoacetic acid is sourced from PubChem (CID 117341642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).