C14H13FN2O — CID 117362429
7-fluoro-5-(1-isocyanatocyclopropyl)-2,3-dimethyl-1H-indole (PubChem CID 117362429) has the molecular formula C14H13FN2O and a molecular weight of 244.27 g/mol. Its IUPAC name is 7-fluoro-5-(1-isocyanatocyclopropyl)-2,3-dimethyl-1H-indole.
| Compound Name | 7-fluoro-5-(1-isocyanatocyclopropyl)-2,3-dimethyl-1H-indole |
|---|---|
| PubChem CID | 117362429 |
| Molecular Formula | C14H13FN2O |
| Molecular Weight | 244.27 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | 7-fluoro-5-(1-isocyanatocyclopropyl)-2,3-dimethyl-1H-indole |
| SMILES | Cc1[nH]c2c(F)cc(C3(N=C=O)CC3)cc2c1C |
| InChI | InChI=1S/C14H13FN2O/c1-8-9(2)17-13-11(8)5-10(6-12(13)15)14(3-4-14)16-7-18/h5-6,17H,3-4H2,1-2H3 |
| InChIKey | WAQIJIJSFBRKSO-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 45.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.27 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|