C11H7F2NO3 — CID 117350005
2,6-difluoro-4-(1-isocyanatocyclopropyl)benzoic acid (PubChem CID 117350005) has the molecular formula C11H7F2NO3 and a molecular weight of 239.18 g/mol. Its IUPAC name is 2,6-difluoro-4-(1-isocyanatocyclopropyl)benzoic acid.
| Compound Name | 2,6-difluoro-4-(1-isocyanatocyclopropyl)benzoic acid |
|---|---|
| PubChem CID | 117350005 |
| Molecular Formula | C11H7F2NO3 |
| Molecular Weight | 239.18 g/mol |
| Exact Mass | 239.04 |
| IUPAC Name | 2,6-difluoro-4-(1-isocyanatocyclopropyl)benzoic acid |
| SMILES | O=C=NC1(c2cc(F)c(C(=O)O)c(F)c2)CC1 |
| InChI | InChI=1S/C11H7F2NO3/c12-7-3-6(11(1-2-11)14-5-15)4-8(13)9(7)10(16)17/h3-4H,1-2H2,(H,16,17) |
| InChIKey | VBOQDBUNEFLZEV-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.18 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|