C15H19NO2 — CID 83964152
7-tert-butyl-2,3-dimethyl-1H-indole-5-carboxylic acid (PubChem CID 83964152) has the molecular formula C15H19NO2 and a molecular weight of 245.32 g/mol. Its IUPAC name is 7-tert-butyl-2,3-dimethyl-1H-indole-5-carboxylic acid.
| Compound Name | 7-tert-butyl-2,3-dimethyl-1H-indole-5-carboxylic acid |
|---|---|
| PubChem CID | 83964152 |
| Molecular Formula | C15H19NO2 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | 7-tert-butyl-2,3-dimethyl-1H-indole-5-carboxylic acid |
| SMILES | Cc1[nH]c2c(C(C)(C)C)cc(C(=O)O)cc2c1C |
| InChI | InChI=1S/C15H19NO2/c1-8-9(2)16-13-11(8)6-10(14(17)18)7-12(13)15(3,4)5/h6-7,16H,1-5H3,(H,17,18) |
| InChIKey | CSGUZAZVFYLTPW-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|