C16H16O4 — CID 23139718
4-tert-butylnaphthalene-2,6-dicarboxylic acid (PubChem CID 23139718) has the molecular formula C16H16O4 and a molecular weight of 272.30 g/mol. Its IUPAC name is 4-tert-butylnaphthalene-2,6-dicarboxylic acid.
| Compound Name | 4-tert-butylnaphthalene-2,6-dicarboxylic acid |
|---|---|
| PubChem CID | 23139718 |
| Molecular Formula | C16H16O4 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 4-tert-butylnaphthalene-2,6-dicarboxylic acid |
| SMILES | CC(C)(C)c1cc(C(=O)O)cc2ccc(C(=O)O)cc12 |
| InChI | InChI=1S/C16H16O4/c1-16(2,3)13-8-11(15(19)20)6-9-4-5-10(14(17)18)7-12(9)13/h4-8H,1-3H3,(H,17,18)(H,19,20) |
| InChIKey | LXZBXCWHADRMCY-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |