C14H21NO2 — CID 117342846
1-[3-(piperidin-3-ylmethyl)phenyl]ethane-1,2-diol (PubChem CID 117342846) has the molecular formula C14H21NO2 and a molecular weight of 235.33 g/mol. Its IUPAC name is 1-[3-(piperidin-3-ylmethyl)phenyl]ethane-1,2-diol.
| Compound Name | 1-[3-(piperidin-3-ylmethyl)phenyl]ethane-1,2-diol |
|---|---|
| PubChem CID | 117342846 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | 1-[3-(piperidin-3-ylmethyl)phenyl]ethane-1,2-diol |
| SMILES | OCC(O)c1cccc(CC2CCCNC2)c1 |
| InChI | InChI=1S/C14H21NO2/c16-10-14(17)13-5-1-3-11(8-13)7-12-4-2-6-15-9-12/h1,3,5,8,12,14-17H,2,4,6-7,9-10H2 |
| InChIKey | SLUOKDRZZJOLGP-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |