C22H31ClN2O — CID 120852327
2-[benzyl(piperidin-3-ylmethyl)amino]-1-(3-methylphenyl)ethanol;hydrochloride (PubChem CID 120852327) has the molecular formula C22H31ClN2O and a molecular weight of 374.96 g/mol. Its IUPAC name is 2-[benzyl(piperidin-3-ylmethyl)amino]-1-(3-methylphenyl)ethanol;hydrochloride.
| Compound Name | 2-[benzyl(piperidin-3-ylmethyl)amino]-1-(3-methylphenyl)ethanol;hydrochloride |
|---|---|
| PubChem CID | 120852327 |
| Molecular Formula | C22H31ClN2O |
| Molecular Weight | 374.96 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | 2-[benzyl(piperidin-3-ylmethyl)amino]-1-(3-methylphenyl)ethanol;hydrochloride |
| SMILES | Cc1cccc(C(O)CN(Cc2ccccc2)CC2CCCNC2)c1.Cl |
| InChI | InChI=1S/C22H30N2O.ClH/c1-18-7-5-11-21(13-18)22(25)17-24(15-19-8-3-2-4-9-19)16-20-10-6-12-23-14-20;/h2-5,7-9,11,13,20,22-23,25H,6,10,12,14-17H2,1H3;1H |
| InChIKey | ZWXMTNXQOZRPLH-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.96 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |