C30H26O12 — CID 11734548
[(2S,3R,4R,5S,6S)-2-[5-(5,7-dihydroxy-4-oxochromen-2-yl)-2-hydroxyphenoxy]-3,5-dihydroxy-6-methyloxan-4-yl] (E)-3-(4-hydroxyphenyl)prop-2-enoate (PubChem CID 11734548) has the molecular formula C30H26O12 and a molecular weight of 578.53 g/mol. Its IUPAC name is [(2S,3R,4R,5S,6S)-2-[5-(5,7-dihydroxy-4-oxochromen-2-yl)-2-hydroxyphenoxy]-3,5-dihydroxy-6-methyloxan-4-yl] (E)-3-(4-hydroxyphenyl)prop-2-enoate.
| Compound Name | [(2S,3R,4R,5S,6S)-2-[5-(5,7-dihydroxy-4-oxochromen-2-yl)-2-hydroxyphenoxy]-3,5-dihydroxy-6-methyloxan-4-yl] (E)-3-(4-hydroxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 11734548 |
| Molecular Formula | C30H26O12 |
| Molecular Weight | 578.53 g/mol |
| Exact Mass | 578.14 |
| IUPAC Name | [(2S,3R,4R,5S,6S)-2-[5-(5,7-dihydroxy-4-oxochromen-2-yl)-2-hydroxyphenoxy]-3,5-dihydroxy-6-methyloxan-4-yl] (E)-3-(4-hydroxyphenyl)prop-2-enoate |
| SMILES | C[C@@H]1O[C@@H](Oc2cc(-c3cc(=O)c4c(O)cc(O)cc4o3)ccc2O)[C@H](O)[C@H](OC(=O)/C=C/c2ccc(O)cc2)[C@H]1O |
| InChI | InChI=1S/C30H26O12/c1-14-27(37)29(42-25(36)9-4-15-2-6-17(31)7-3-15)28(38)30(39-14)41-23-10-16(5-8-19(23)33)22-13-21(35)26-20(34)11-18(32)12-24(26)40-22/h2-14,27-34,37-38H,1H3/b9-4+/t14-,27-,28+,29+,30-/m0/s1 |
| InChIKey | WFOXEJOHYRIRDJ-SZLPPBIYSA-N |
| XLogP | 2.75 |
| TPSA | 196.35 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.53 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|