C13H16FNO2 — CID 117346664
1-(6-fluoro-4H-1,3-benzodioxin-8-yl)cyclopentan-1-amine (PubChem CID 117346664) has the molecular formula C13H16FNO2 and a molecular weight of 237.27 g/mol. Its IUPAC name is 1-(6-fluoro-4H-1,3-benzodioxin-8-yl)cyclopentan-1-amine.
| Compound Name | 1-(6-fluoro-4H-1,3-benzodioxin-8-yl)cyclopentan-1-amine |
|---|---|
| PubChem CID | 117346664 |
| Molecular Formula | C13H16FNO2 |
| Molecular Weight | 237.27 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | 1-(6-fluoro-4H-1,3-benzodioxin-8-yl)cyclopentan-1-amine |
| SMILES | NC1(c2cc(F)cc3c2OCOC3)CCCC1 |
| InChI | InChI=1S/C13H16FNO2/c14-10-5-9-7-16-8-17-12(9)11(6-10)13(15)3-1-2-4-13/h5-6H,1-4,7-8,15H2 |
| InChIKey | PUCWLSFJLDQBGM-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.27 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |