C36H25F7O2 — CID 11734811
1,2,4,5-tetrafluoro-3-[4-[(Z)-2-phenyl-1-(4-phenylmethoxyphenyl)but-1-enyl]phenoxy]-6-(trifluoromethyl)benzene (PubChem CID 11734811) has the molecular formula C36H25F7O2 and a molecular weight of 622.58 g/mol. Its IUPAC name is 1,2,4,5-tetrafluoro-3-[4-[(Z)-2-phenyl-1-(4-phenylmethoxyphenyl)but-1-enyl]phenoxy]-6-(trifluoromethyl)benzene.
| Compound Name | 1,2,4,5-tetrafluoro-3-[4-[(Z)-2-phenyl-1-(4-phenylmethoxyphenyl)but-1-enyl]phenoxy]-6-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 11734811 |
| Molecular Formula | C36H25F7O2 |
| Molecular Weight | 622.58 g/mol |
| Exact Mass | 622.17 |
| IUPAC Name | 1,2,4,5-tetrafluoro-3-[4-[(Z)-2-phenyl-1-(4-phenylmethoxyphenyl)but-1-enyl]phenoxy]-6-(trifluoromethyl)benzene |
| SMILES | CC/C(=C(\c1ccc(OCc2ccccc2)cc1)c1ccc(Oc2c(F)c(F)c(C(F)(F)F)c(F)c2F)cc1)c1ccccc1 |
| InChI | InChI=1S/C36H25F7O2/c1-2-28(23-11-7-4-8-12-23)29(24-13-17-26(18-14-24)44-21-22-9-5-3-6-10-22)25-15-19-27(20-16-25)45-35-33(39)31(37)30(36(41,42)43)32(38)34(35)40/h3-20H,2,21H2,1H3/b29-28- |
| InChIKey | CEXVMOAINXOXGQ-ZIADKAODSA-N |
| XLogP | 11.00 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.58 |
| LogP ≤ 5 | 11.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|