C12H14FNO3 — CID 117350341
7-(1-aminocyclobutyl)-5-fluoro-2,3-dihydro-1,4-benzodioxin-6-ol (PubChem CID 117350341) has the molecular formula C12H14FNO3 and a molecular weight of 239.25 g/mol. Its IUPAC name is 7-(1-aminocyclobutyl)-5-fluoro-2,3-dihydro-1,4-benzodioxin-6-ol.
| Compound Name | 7-(1-aminocyclobutyl)-5-fluoro-2,3-dihydro-1,4-benzodioxin-6-ol |
|---|---|
| PubChem CID | 117350341 |
| Molecular Formula | C12H14FNO3 |
| Molecular Weight | 239.25 g/mol |
| Exact Mass | 239.10 |
| IUPAC Name | 7-(1-aminocyclobutyl)-5-fluoro-2,3-dihydro-1,4-benzodioxin-6-ol |
| SMILES | NC1(c2cc3c(c(F)c2O)OCCO3)CCC1 |
| InChI | InChI=1S/C12H14FNO3/c13-9-10(15)7(12(14)2-1-3-12)6-8-11(9)17-5-4-16-8/h6,15H,1-5,14H2 |
| InChIKey | GJKFTTAAMYNFSR-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.25 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|