C12H17NO4 — CID 117350636
5-[1-hydroxy-2-(methylamino)ethyl]-2,3-dimethoxybenzaldehyde (PubChem CID 117350636) has the molecular formula C12H17NO4 and a molecular weight of 239.27 g/mol. Its IUPAC name is 5-[1-hydroxy-2-(methylamino)ethyl]-2,3-dimethoxybenzaldehyde.
| Compound Name | 5-[1-hydroxy-2-(methylamino)ethyl]-2,3-dimethoxybenzaldehyde |
|---|---|
| PubChem CID | 117350636 |
| Molecular Formula | C12H17NO4 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | 5-[1-hydroxy-2-(methylamino)ethyl]-2,3-dimethoxybenzaldehyde |
| SMILES | CNCC(O)c1cc(C=O)c(OC)c(OC)c1 |
| InChI | InChI=1S/C12H17NO4/c1-13-6-10(15)8-4-9(7-14)12(17-3)11(5-8)16-2/h4-5,7,10,13,15H,6H2,1-3H3 |
| InChIKey | GTMQRDDMCACNGG-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|