C16H20N2 — CID 117353788
7-(pyrrolidin-2-ylmethyl)-1,2,3,4-tetrahydrocyclopenta[b]indole (PubChem CID 117353788) has the molecular formula C16H20N2 and a molecular weight of 240.35 g/mol. Its IUPAC name is 7-(pyrrolidin-2-ylmethyl)-1,2,3,4-tetrahydrocyclopenta[b]indole.
| Compound Name | 7-(pyrrolidin-2-ylmethyl)-1,2,3,4-tetrahydrocyclopenta[b]indole |
|---|---|
| PubChem CID | 117353788 |
| Molecular Formula | C16H20N2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | 7-(pyrrolidin-2-ylmethyl)-1,2,3,4-tetrahydrocyclopenta[b]indole |
| SMILES | c1cc2[nH]c3c(c2cc1CC1CCCN1)CCC3 |
| InChI | InChI=1S/C16H20N2/c1-4-13-14-10-11(9-12-3-2-8-17-12)6-7-16(14)18-15(13)5-1/h6-7,10,12,17-18H,1-5,8-9H2 |
| InChIKey | PDDRSMXURMDSBY-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|