C13H13N3S — CID 117360675
4-(2,3-dimethyl-1-benzothiophen-6-yl)-1H-pyrazol-5-amine (PubChem CID 117360675) has the molecular formula C13H13N3S and a molecular weight of 243.34 g/mol. Its IUPAC name is 4-(2,3-dimethyl-1-benzothiophen-6-yl)-1H-pyrazol-5-amine.
| Compound Name | 4-(2,3-dimethyl-1-benzothiophen-6-yl)-1H-pyrazol-5-amine |
|---|---|
| PubChem CID | 117360675 |
| Molecular Formula | C13H13N3S |
| Molecular Weight | 243.34 g/mol |
| Exact Mass | 243.08 |
| IUPAC Name | 4-(2,3-dimethyl-1-benzothiophen-6-yl)-1H-pyrazol-5-amine |
| SMILES | Cc1sc2cc(-c3cn[nH]c3N)ccc2c1C |
| InChI | InChI=1S/C13H13N3S/c1-7-8(2)17-12-5-9(3-4-10(7)12)11-6-15-16-13(11)14/h3-6H,1-2H3,(H3,14,15,16) |
| InChIKey | UNPFXCWEKMPKFD-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.34 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |