C12H17F2NO2 — CID 117364611
1-[3-(difluoromethyl)-2-methoxy-6-methylphenyl]-2-(methylamino)ethanol (PubChem CID 117364611) has the molecular formula C12H17F2NO2 and a molecular weight of 245.27 g/mol. Its IUPAC name is 1-[3-(difluoromethyl)-2-methoxy-6-methylphenyl]-2-(methylamino)ethanol.
| Compound Name | 1-[3-(difluoromethyl)-2-methoxy-6-methylphenyl]-2-(methylamino)ethanol |
|---|---|
| PubChem CID | 117364611 |
| Molecular Formula | C12H17F2NO2 |
| Molecular Weight | 245.27 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | 1-[3-(difluoromethyl)-2-methoxy-6-methylphenyl]-2-(methylamino)ethanol |
| SMILES | CNCC(O)c1c(C)ccc(C(F)F)c1OC |
| InChI | InChI=1S/C12H17F2NO2/c1-7-4-5-8(12(13)14)11(17-3)10(7)9(16)6-15-2/h4-5,9,12,15-16H,6H2,1-3H3 |
| InChIKey | AWRMVIFBYQDCSP-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.27 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |