C16H30O — CID 11736566
(2R,3S)-2-dodecyl-3-ethenyloxirane (PubChem CID 11736566) has the molecular formula C16H30O and a molecular weight of 238.41 g/mol. Its IUPAC name is (2R,3S)-2-dodecyl-3-ethenyloxirane.
| Compound Name | (2R,3S)-2-dodecyl-3-ethenyloxirane |
|---|---|
| PubChem CID | 11736566 |
| Molecular Formula | C16H30O |
| Molecular Weight | 238.41 g/mol |
| Exact Mass | 238.23 |
| IUPAC Name | (2R,3S)-2-dodecyl-3-ethenyloxirane |
| SMILES | C=C[C@@H]1O[C@@H]1CCCCCCCCCCCC |
| InChI | InChI=1S/C16H30O/c1-3-5-6-7-8-9-10-11-12-13-14-16-15(4-2)17-16/h4,15-16H,2-3,5-14H2,1H3/t15-,16+/m0/s1 |
| InChIKey | BUHPSWFXZDASGL-JKSUJKDBSA-N |
| XLogP | 5.25 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.41 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|