C17H14N2 — CID 117368332
9-(cyclopropylmethyl)carbazole-3-carbonitrile (PubChem CID 117368332) has the molecular formula C17H14N2 and a molecular weight of 246.31 g/mol. Its IUPAC name is 9-(cyclopropylmethyl)carbazole-3-carbonitrile.
| Compound Name | 9-(cyclopropylmethyl)carbazole-3-carbonitrile |
|---|---|
| PubChem CID | 117368332 |
| Molecular Formula | C17H14N2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | 9-(cyclopropylmethyl)carbazole-3-carbonitrile |
| SMILES | N#Cc1ccc2c(c1)c1ccccc1n2CC1CC1 |
| InChI | InChI=1S/C17H14N2/c18-10-13-7-8-17-15(9-13)14-3-1-2-4-16(14)19(17)11-12-5-6-12/h1-4,7-9,12H,5-6,11H2 |
| InChIKey | JNNRWZJLMAGTMT-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 28.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |