C14H18N2S — CID 117368801
4-(2-cyclopropyl-1,3-benzothiazol-4-yl)butan-1-amine (PubChem CID 117368801) has the molecular formula C14H18N2S and a molecular weight of 246.38 g/mol. Its IUPAC name is 4-(2-cyclopropyl-1,3-benzothiazol-4-yl)butan-1-amine.
| Compound Name | 4-(2-cyclopropyl-1,3-benzothiazol-4-yl)butan-1-amine |
|---|---|
| PubChem CID | 117368801 |
| Molecular Formula | C14H18N2S |
| Molecular Weight | 246.38 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | 4-(2-cyclopropyl-1,3-benzothiazol-4-yl)butan-1-amine |
| SMILES | NCCCCc1cccc2sc(C3CC3)nc12 |
| InChI | InChI=1S/C14H18N2S/c15-9-2-1-4-10-5-3-6-12-13(10)16-14(17-12)11-7-8-11/h3,5-6,11H,1-2,4,7-9,15H2 |
| InChIKey | DDWGVAFHBXYFKF-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.38 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|