C16H20N2S — CID 117434100
1-(2-cyclopropyl-1,3-benzothiazol-4-yl)cyclohexan-1-amine (PubChem CID 117434100) has the molecular formula C16H20N2S and a molecular weight of 272.42 g/mol. Its IUPAC name is 1-(2-cyclopropyl-1,3-benzothiazol-4-yl)cyclohexan-1-amine.
| Compound Name | 1-(2-cyclopropyl-1,3-benzothiazol-4-yl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 117434100 |
| Molecular Formula | C16H20N2S |
| Molecular Weight | 272.42 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | 1-(2-cyclopropyl-1,3-benzothiazol-4-yl)cyclohexan-1-amine |
| SMILES | NC1(c2cccc3sc(C4CC4)nc23)CCCCC1 |
| InChI | InChI=1S/C16H20N2S/c17-16(9-2-1-3-10-16)12-5-4-6-13-14(12)18-15(19-13)11-7-8-11/h4-6,11H,1-3,7-10,17H2 |
| InChIKey | ACPZAOZFWJXZGX-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.42 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |