C12H14N2S — CID 139087737
2-cyclohexyl-[1,3]thiazolo[4,5-b]pyridine (PubChem CID 139087737) has the molecular formula C12H14N2S and a molecular weight of 218.32 g/mol. Its IUPAC name is 2-cyclohexyl-[1,3]thiazolo[4,5-b]pyridine.
| Compound Name | 2-cyclohexyl-[1,3]thiazolo[4,5-b]pyridine |
|---|---|
| PubChem CID | 139087737 |
| Molecular Formula | C12H14N2S |
| Molecular Weight | 218.32 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | 2-cyclohexyl-[1,3]thiazolo[4,5-b]pyridine |
| SMILES | c1cnc2nc(C3CCCCC3)sc2c1 |
| InChI | InChI=1S/C12H14N2S/c1-2-5-9(6-3-1)12-14-11-10(15-12)7-4-8-13-11/h4,7-9H,1-3,5-6H2 |
| InChIKey | IVWAYYPBRVCKJL-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.32 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |