C11H13N3S — CID 169285097
6-cyclohexyl-[1,3]thiazolo[4,5-c]pyridazine (PubChem CID 169285097) has the molecular formula C11H13N3S and a molecular weight of 219.31 g/mol. Its IUPAC name is 6-cyclohexyl-[1,3]thiazolo[4,5-c]pyridazine.
| Compound Name | 6-cyclohexyl-[1,3]thiazolo[4,5-c]pyridazine |
|---|---|
| PubChem CID | 169285097 |
| Molecular Formula | C11H13N3S |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | 6-cyclohexyl-[1,3]thiazolo[4,5-c]pyridazine |
| SMILES | c1cc2sc(C3CCCCC3)nc2nn1 |
| InChI | InChI=1S/C11H13N3S/c1-2-4-8(5-3-1)11-13-10-9(15-11)6-7-12-14-10/h6-8H,1-5H2 |
| InChIKey | LETCJKRAFKTUCK-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |