C20H33N3S — CID 174110051
1-(4-decyl-1,3-benzothiazol-2-yl)propane-1,3-diamine (PubChem CID 174110051) has the molecular formula C20H33N3S and a molecular weight of 347.57 g/mol. Its IUPAC name is 1-(4-decyl-1,3-benzothiazol-2-yl)propane-1,3-diamine.
| Compound Name | 1-(4-decyl-1,3-benzothiazol-2-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 174110051 |
| Molecular Formula | C20H33N3S |
| Molecular Weight | 347.57 g/mol |
| Exact Mass | 347.24 |
| IUPAC Name | 1-(4-decyl-1,3-benzothiazol-2-yl)propane-1,3-diamine |
| SMILES | CCCCCCCCCCc1cccc2sc(C(N)CCN)nc12 |
| InChI | InChI=1S/C20H33N3S/c1-2-3-4-5-6-7-8-9-11-16-12-10-13-18-19(16)23-20(24-18)17(22)14-15-21/h10,12-13,17H,2-9,11,14-15,21-22H2,1H3 |
| InChIKey | KWHBVNOKZIXBHD-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.57 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|