C12H11NO5 — CID 117375270
methyl 2,4-dihydroxy-5-(1-isocyanatocyclopropyl)benzoate (PubChem CID 117375270) has the molecular formula C12H11NO5 and a molecular weight of 249.22 g/mol. Its IUPAC name is methyl 2,4-dihydroxy-5-(1-isocyanatocyclopropyl)benzoate.
| Compound Name | methyl 2,4-dihydroxy-5-(1-isocyanatocyclopropyl)benzoate |
|---|---|
| PubChem CID | 117375270 |
| Molecular Formula | C12H11NO5 |
| Molecular Weight | 249.22 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | methyl 2,4-dihydroxy-5-(1-isocyanatocyclopropyl)benzoate |
| SMILES | COC(=O)c1cc(C2(N=C=O)CC2)c(O)cc1O |
| InChI | InChI=1S/C12H11NO5/c1-18-11(17)7-4-8(10(16)5-9(7)15)12(2-3-12)13-6-14/h4-5,15-16H,2-3H2,1H3 |
| InChIKey | HGXTXSQDWUDYIL-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 96.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.22 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|