C13H13NO3 — CID 117333973
5-(1-isocyanatocyclopropyl)-2,4-dimethylbenzoic acid (PubChem CID 117333973) has the molecular formula C13H13NO3 and a molecular weight of 231.25 g/mol. Its IUPAC name is 5-(1-isocyanatocyclopropyl)-2,4-dimethylbenzoic acid.
| Compound Name | 5-(1-isocyanatocyclopropyl)-2,4-dimethylbenzoic acid |
|---|---|
| PubChem CID | 117333973 |
| Molecular Formula | C13H13NO3 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | 5-(1-isocyanatocyclopropyl)-2,4-dimethylbenzoic acid |
| SMILES | Cc1cc(C)c(C2(N=C=O)CC2)cc1C(=O)O |
| InChI | InChI=1S/C13H13NO3/c1-8-5-9(2)11(6-10(8)12(16)17)13(3-4-13)14-7-15/h5-6H,3-4H2,1-2H3,(H,16,17) |
| InChIKey | CIWKINXNMRCXQA-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|