About 4-(7-fluoro-3,4-dihydro-2H-1,5-benzodioxepin-6-yl)-1H-pyrazol-5-amine
4-(7-fluoro-3,4-dihydro-2H-1,5-benzodioxepin-6-yl)-1H-pyrazol-5-amine (PubChem CID 117375445) has the molecular formula C12H12FN3O2
and a molecular weight of 249.24 g/mol. Its IUPAC name is 4-(7-fluoro-3,4-dihydro-2H-1,5-benzodioxepin-6-yl)-1H-pyrazol-5-amine.
Molecular Properties
| Compound Name | 4-(7-fluoro-3,4-dihydro-2H-1,5-benzodioxepin-6-yl)-1H-pyrazol-5-amine |
| PubChem CID | 117375445 |
| Molecular Formula | C12H12FN3O2 |
| Molecular Weight | 249.24 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | 4-(7-fluoro-3,4-dihydro-2H-1,5-benzodioxepin-6-yl)-1H-pyrazol-5-amine |
| SMILES | Nc1[nH]ncc1-c1c(F)ccc2c1OCCCO2 |
| InChI | InChI=1S/C12H12FN3O2/c13-8-2-3-9-11(18-5-1-4-17-9)10(8)7-6-15-16-12(7)14/h2-3,6H,1,4-5H2,(H3,14,15,16) |
| InChIKey | XKHVTMACXNYFEY-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 73.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.24 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(7-fluoro-3,4-dihydro-2H-1,5-benzodioxepin-6-yl)-1H-pyrazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(7-fluoro-3,4-dihydro-2H-1,5-benzodioxepin-6-yl)-1H-pyrazol-5-amine?
The IUPAC name of 4-(7-fluoro-3,4-dihydro-2H-1,5-benzodioxepin-6-yl)-1H-pyrazol-5-amine (CID 117375445) is 4-(7-fluoro-3,4-dihydro-2H-1,5-benzodioxepin-6-yl)-1H-pyrazol-5-amine.
What is the SMILES notation for 4-(7-fluoro-3,4-dihydro-2H-1,5-benzodioxepin-6-yl)-1H-pyrazol-5-amine?
The canonical SMILES for 4-(7-fluoro-3,4-dihydro-2H-1,5-benzodioxepin-6-yl)-1H-pyrazol-5-amine is Nc1[nH]ncc1-c1c(F)ccc2c1OCCCO2.
What is the InChIKey of 4-(7-fluoro-3,4-dihydro-2H-1,5-benzodioxepin-6-yl)-1H-pyrazol-5-amine?
The InChIKey is XKHVTMACXNYFEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12FN3O2/c13-8-2-3-9-11(18-5-1-4-17-9)10(8)7-6-15-16-12(7)14/h2-3,6H,1,4-5H2,(H3,14,15,16).
What are the key properties of 4-(7-fluoro-3,4-dihydro-2H-1,5-benzodioxepin-6-yl)-1H-pyrazol-5-amine?
4-(7-fluoro-3,4-dihydro-2H-1,5-benzodioxepin-6-yl)-1H-pyrazol-5-amine has a molecular weight of 249.24 g/mol, XLogP of 1.96, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(7-fluoro-3,4-dihydro-2H-1,5-benzodioxepin-6-yl)-1H-pyrazol-5-amine is sourced from PubChem (CID 117375445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).