About 5-(1,1-dioxo-2,3-dihydro-1-benzothiophen-5-yl)-1H-pyrazol-3-amine
5-(1,1-dioxo-2,3-dihydro-1-benzothiophen-5-yl)-1H-pyrazol-3-amine (PubChem CID 117376014) has the molecular formula C11H11N3O2S
and a molecular weight of 249.30 g/mol. Its IUPAC name is 5-(1,1-dioxo-2,3-dihydro-1-benzothiophen-5-yl)-1H-pyrazol-3-amine.
Molecular Properties
| Compound Name | 5-(1,1-dioxo-2,3-dihydro-1-benzothiophen-5-yl)-1H-pyrazol-3-amine |
| PubChem CID | 117376014 |
| Molecular Formula | C11H11N3O2S |
| Molecular Weight | 249.30 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | 5-(1,1-dioxo-2,3-dihydro-1-benzothiophen-5-yl)-1H-pyrazol-3-amine |
| SMILES | Nc1cc(-c2ccc3c(c2)CCS3(=O)=O)[nH]n1 |
| InChI | InChI=1S/C11H11N3O2S/c12-11-6-9(13-14-11)7-1-2-10-8(5-7)3-4-17(10,15)16/h1-2,5-6H,3-4H2,(H3,12,13,14) |
| InChIKey | YMPVPOZKGKQHQJ-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 88.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.30 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(1,1-dioxo-2,3-dihydro-1-benzothiophen-5-yl)-1H-pyrazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1,1-dioxo-2,3-dihydro-1-benzothiophen-5-yl)-1H-pyrazol-3-amine?
The IUPAC name of 5-(1,1-dioxo-2,3-dihydro-1-benzothiophen-5-yl)-1H-pyrazol-3-amine (CID 117376014) is 5-(1,1-dioxo-2,3-dihydro-1-benzothiophen-5-yl)-1H-pyrazol-3-amine.
What is the SMILES notation for 5-(1,1-dioxo-2,3-dihydro-1-benzothiophen-5-yl)-1H-pyrazol-3-amine?
The canonical SMILES for 5-(1,1-dioxo-2,3-dihydro-1-benzothiophen-5-yl)-1H-pyrazol-3-amine is Nc1cc(-c2ccc3c(c2)CCS3(=O)=O)[nH]n1.
What is the InChIKey of 5-(1,1-dioxo-2,3-dihydro-1-benzothiophen-5-yl)-1H-pyrazol-3-amine?
The InChIKey is YMPVPOZKGKQHQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N3O2S/c12-11-6-9(13-14-11)7-1-2-10-8(5-7)3-4-17(10,15)16/h1-2,5-6H,3-4H2,(H3,12,13,14).
What are the key properties of 5-(1,1-dioxo-2,3-dihydro-1-benzothiophen-5-yl)-1H-pyrazol-3-amine?
5-(1,1-dioxo-2,3-dihydro-1-benzothiophen-5-yl)-1H-pyrazol-3-amine has a molecular weight of 249.30 g/mol, XLogP of 0.99, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1,1-dioxo-2,3-dihydro-1-benzothiophen-5-yl)-1H-pyrazol-3-amine is sourced from PubChem (CID 117376014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).