C12H12N2O3S — CID 116832452
4-(1,1-dioxo-3,4-dihydro-2H-thiochromen-6-yl)-1,3-oxazol-2-amine (PubChem CID 116832452) has the molecular formula C12H12N2O3S and a molecular weight of 264.31 g/mol. Its IUPAC name is 4-(1,1-dioxo-3,4-dihydro-2H-thiochromen-6-yl)-1,3-oxazol-2-amine.
| Compound Name | 4-(1,1-dioxo-3,4-dihydro-2H-thiochromen-6-yl)-1,3-oxazol-2-amine |
|---|---|
| PubChem CID | 116832452 |
| Molecular Formula | C12H12N2O3S |
| Molecular Weight | 264.31 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | 4-(1,1-dioxo-3,4-dihydro-2H-thiochromen-6-yl)-1,3-oxazol-2-amine |
| SMILES | Nc1nc(-c2ccc3c(c2)CCCS3(=O)=O)co1 |
| InChI | InChI=1S/C12H12N2O3S/c13-12-14-10(7-17-12)8-3-4-11-9(6-8)2-1-5-18(11,15)16/h3-4,6-7H,1-2,5H2,(H2,13,14) |
| InChIKey | ARFJHZPZNIZWLJ-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 86.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.31 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |