C16H12N2O — CID 62065372
4-(9H-fluoren-2-yl)-1,3-oxazol-2-amine (PubChem CID 62065372) has the molecular formula C16H12N2O and a molecular weight of 248.28 g/mol. Its IUPAC name is 4-(9H-fluoren-2-yl)-1,3-oxazol-2-amine.
| Compound Name | 4-(9H-fluoren-2-yl)-1,3-oxazol-2-amine |
|---|---|
| PubChem CID | 62065372 |
| Molecular Formula | C16H12N2O |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | 4-(9H-fluoren-2-yl)-1,3-oxazol-2-amine |
| SMILES | Nc1nc(-c2ccc3c(c2)Cc2ccccc2-3)co1 |
| InChI | InChI=1S/C16H12N2O/c17-16-18-15(9-19-16)11-5-6-14-12(8-11)7-10-3-1-2-4-13(10)14/h1-6,8-9H,7H2,(H2,17,18) |
| InChIKey | SXGYFNRECXPOFI-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |