C12H12N2OS — CID 116832451
4-(3,4-dihydro-2H-thiochromen-6-yl)-1,3-oxazol-2-amine (PubChem CID 116832451) has the molecular formula C12H12N2OS and a molecular weight of 232.31 g/mol. Its IUPAC name is 4-(3,4-dihydro-2H-thiochromen-6-yl)-1,3-oxazol-2-amine.
| Compound Name | 4-(3,4-dihydro-2H-thiochromen-6-yl)-1,3-oxazol-2-amine |
|---|---|
| PubChem CID | 116832451 |
| Molecular Formula | C12H12N2OS |
| Molecular Weight | 232.31 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | 4-(3,4-dihydro-2H-thiochromen-6-yl)-1,3-oxazol-2-amine |
| SMILES | Nc1nc(-c2ccc3c(c2)CCCS3)co1 |
| InChI | InChI=1S/C12H12N2OS/c13-12-14-10(7-15-12)8-3-4-11-9(6-8)2-1-5-16-11/h3-4,6-7H,1-2,5H2,(H2,13,14) |
| InChIKey | RDSYKWKGRZQSMC-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.31 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |