C12H13N3S — CID 117334794
5-(3,4-dihydro-2H-thiochromen-7-yl)-1H-pyrazol-3-amine (PubChem CID 117334794) has the molecular formula C12H13N3S and a molecular weight of 231.32 g/mol. Its IUPAC name is 5-(3,4-dihydro-2H-thiochromen-7-yl)-1H-pyrazol-3-amine.
| Compound Name | 5-(3,4-dihydro-2H-thiochromen-7-yl)-1H-pyrazol-3-amine |
|---|---|
| PubChem CID | 117334794 |
| Molecular Formula | C12H13N3S |
| Molecular Weight | 231.32 g/mol |
| Exact Mass | 231.08 |
| IUPAC Name | 5-(3,4-dihydro-2H-thiochromen-7-yl)-1H-pyrazol-3-amine |
| SMILES | Nc1cc(-c2ccc3c(c2)SCCC3)[nH]n1 |
| InChI | InChI=1S/C12H13N3S/c13-12-7-10(14-15-12)9-4-3-8-2-1-5-16-11(8)6-9/h3-4,6-7H,1-2,5H2,(H3,13,14,15) |
| InChIKey | GWGYECOAVXLNLY-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.32 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |