C10H18BrO3P — CID 11738036
(1Z)-1-bromo-1-diethoxyphosphorylhexa-1,5-diene (PubChem CID 11738036) has the molecular formula C10H18BrO3P and a molecular weight of 297.13 g/mol. Its IUPAC name is (1Z)-1-bromo-1-diethoxyphosphorylhexa-1,5-diene.
| Compound Name | (1Z)-1-bromo-1-diethoxyphosphorylhexa-1,5-diene |
|---|---|
| PubChem CID | 11738036 |
| Molecular Formula | C10H18BrO3P |
| Molecular Weight | 297.13 g/mol |
| Exact Mass | 296.02 |
| IUPAC Name | (1Z)-1-bromo-1-diethoxyphosphorylhexa-1,5-diene |
| SMILES | C=CCC/C=C(\Br)P(=O)(OCC)OCC |
| InChI | InChI=1S/C10H18BrO3P/c1-4-7-8-9-10(11)15(12,13-5-2)14-6-3/h4,9H,1,5-8H2,2-3H3/b10-9+ |
| InChIKey | AKBJURLFMOZJCW-MDZDMXLPSA-N |
| XLogP | 4.45 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.13 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|