C13H17NO4 — CID 117380954
5-(1-amino-3-carboxypropyl)-2,3-dimethylbenzoic acid (PubChem CID 117380954) has the molecular formula C13H17NO4 and a molecular weight of 251.28 g/mol. Its IUPAC name is 5-(1-amino-3-carboxypropyl)-2,3-dimethylbenzoic acid.
| Compound Name | 5-(1-amino-3-carboxypropyl)-2,3-dimethylbenzoic acid |
|---|---|
| PubChem CID | 117380954 |
| Molecular Formula | C13H17NO4 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | 5-(1-amino-3-carboxypropyl)-2,3-dimethylbenzoic acid |
| SMILES | Cc1cc(C(N)CCC(=O)O)cc(C(=O)O)c1C |
| InChI | InChI=1S/C13H17NO4/c1-7-5-9(11(14)3-4-12(15)16)6-10(8(7)2)13(17)18/h5-6,11H,3-4,14H2,1-2H3,(H,15,16)(H,17,18) |
| InChIKey | OXFFKXBUCMBWFD-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |