C12H16BrNO2 — CID 84813620
4-amino-4-(3-bromo-4,5-dimethylphenyl)butanoic acid (PubChem CID 84813620) has the molecular formula C12H16BrNO2 and a molecular weight of 286.17 g/mol. Its IUPAC name is 4-amino-4-(3-bromo-4,5-dimethylphenyl)butanoic acid.
| Compound Name | 4-amino-4-(3-bromo-4,5-dimethylphenyl)butanoic acid |
|---|---|
| PubChem CID | 84813620 |
| Molecular Formula | C12H16BrNO2 |
| Molecular Weight | 286.17 g/mol |
| Exact Mass | 285.04 |
| IUPAC Name | 4-amino-4-(3-bromo-4,5-dimethylphenyl)butanoic acid |
| SMILES | Cc1cc(C(N)CCC(=O)O)cc(Br)c1C |
| InChI | InChI=1S/C12H16BrNO2/c1-7-5-9(6-10(13)8(7)2)11(14)3-4-12(15)16/h5-6,11H,3-4,14H2,1-2H3,(H,15,16) |
| InChIKey | KNVYSHWBBOAIKY-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.17 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |