C11H13F2NO2S — CID 117407125
4-amino-4-(3,5-difluoro-4-methylsulfanylphenyl)butanoic acid (PubChem CID 117407125) has the molecular formula C11H13F2NO2S and a molecular weight of 261.29 g/mol. Its IUPAC name is 4-amino-4-(3,5-difluoro-4-methylsulfanylphenyl)butanoic acid.
| Compound Name | 4-amino-4-(3,5-difluoro-4-methylsulfanylphenyl)butanoic acid |
|---|---|
| PubChem CID | 117407125 |
| Molecular Formula | C11H13F2NO2S |
| Molecular Weight | 261.29 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | 4-amino-4-(3,5-difluoro-4-methylsulfanylphenyl)butanoic acid |
| SMILES | CSc1c(F)cc(C(N)CCC(=O)O)cc1F |
| InChI | InChI=1S/C11H13F2NO2S/c1-17-11-7(12)4-6(5-8(11)13)9(14)2-3-10(15)16/h4-5,9H,2-3,14H2,1H3,(H,15,16) |
| InChIKey | PHEKNSSGNOBGTL-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.29 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |