C11H13F2NO2S — CID 117407129
4-amino-4-[3-(difluoromethylsulfanyl)phenyl]butanoic acid (PubChem CID 117407129) has the molecular formula C11H13F2NO2S and a molecular weight of 261.29 g/mol. Its IUPAC name is 4-amino-4-[3-(difluoromethylsulfanyl)phenyl]butanoic acid.
| Compound Name | 4-amino-4-[3-(difluoromethylsulfanyl)phenyl]butanoic acid |
|---|---|
| PubChem CID | 117407129 |
| Molecular Formula | C11H13F2NO2S |
| Molecular Weight | 261.29 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | 4-amino-4-[3-(difluoromethylsulfanyl)phenyl]butanoic acid |
| SMILES | NC(CCC(=O)O)c1cccc(SC(F)F)c1 |
| InChI | InChI=1S/C11H13F2NO2S/c12-11(13)17-8-3-1-2-7(6-8)9(14)4-5-10(15)16/h1-3,6,9,11H,4-5,14H2,(H,15,16) |
| InChIKey | NLSCYINGLSUNNI-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.29 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |