About 4-amino-4-[3-(2-oxo-1,3-dihydroimidazol-4-yl)phenyl]butanoic acid
4-amino-4-[3-(2-oxo-1,3-dihydroimidazol-4-yl)phenyl]butanoic acid (PubChem CID 117407041) has the molecular formula C13H15N3O3
and a molecular weight of 261.28 g/mol. Its IUPAC name is 4-amino-4-[3-(2-oxo-1,3-dihydroimidazol-4-yl)phenyl]butanoic acid.
Molecular Properties
| Compound Name | 4-amino-4-[3-(2-oxo-1,3-dihydroimidazol-4-yl)phenyl]butanoic acid |
| PubChem CID | 117407041 |
| Molecular Formula | C13H15N3O3 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | 4-amino-4-[3-(2-oxo-1,3-dihydroimidazol-4-yl)phenyl]butanoic acid |
| SMILES | NC(CCC(=O)O)c1cccc(-c2c[nH]c(=O)[nH]2)c1 |
| InChI | InChI=1S/C13H15N3O3/c14-10(4-5-12(17)18)8-2-1-3-9(6-8)11-7-15-13(19)16-11/h1-3,6-7,10H,4-5,14H2,(H,17,18)(H2,15,16,19) |
| InChIKey | UTPCMHPPNXGABY-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 111.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-amino-4-[3-(2-oxo-1,3-dihydroimidazol-4-yl)phenyl]butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-4-[3-(2-oxo-1,3-dihydroimidazol-4-yl)phenyl]butanoic acid?
The IUPAC name of 4-amino-4-[3-(2-oxo-1,3-dihydroimidazol-4-yl)phenyl]butanoic acid (CID 117407041) is 4-amino-4-[3-(2-oxo-1,3-dihydroimidazol-4-yl)phenyl]butanoic acid.
What is the SMILES notation for 4-amino-4-[3-(2-oxo-1,3-dihydroimidazol-4-yl)phenyl]butanoic acid?
The canonical SMILES for 4-amino-4-[3-(2-oxo-1,3-dihydroimidazol-4-yl)phenyl]butanoic acid is NC(CCC(=O)O)c1cccc(-c2c[nH]c(=O)[nH]2)c1.
What is the InChIKey of 4-amino-4-[3-(2-oxo-1,3-dihydroimidazol-4-yl)phenyl]butanoic acid?
The InChIKey is UTPCMHPPNXGABY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15N3O3/c14-10(4-5-12(17)18)8-2-1-3-9(6-8)11-7-15-13(19)16-11/h1-3,6-7,10H,4-5,14H2,(H,17,18)(H2,15,16,19).
What are the key properties of 4-amino-4-[3-(2-oxo-1,3-dihydroimidazol-4-yl)phenyl]butanoic acid?
4-amino-4-[3-(2-oxo-1,3-dihydroimidazol-4-yl)phenyl]butanoic acid has a molecular weight of 261.28 g/mol, XLogP of 1.23, 5 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-4-[3-(2-oxo-1,3-dihydroimidazol-4-yl)phenyl]butanoic acid is sourced from PubChem (CID 117407041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).